C22H34N2O5 — CID 122587612
ethyl 3-ethyl-3-[4-[ethyl(oxan-4-yl)amino]-3-nitrophenyl]pentanoate (PubChem CID 122587612) has the molecular formula C22H34N2O5 and a molecular weight of 406.52 g/mol. Its IUPAC name is ethyl 3-ethyl-3-[4-[ethyl(oxan-4-yl)amino]-3-nitrophenyl]pentanoate.
| Compound Name | ethyl 3-ethyl-3-[4-[ethyl(oxan-4-yl)amino]-3-nitrophenyl]pentanoate |
|---|---|
| PubChem CID | 122587612 |
| Molecular Formula | C22H34N2O5 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | ethyl 3-ethyl-3-[4-[ethyl(oxan-4-yl)amino]-3-nitrophenyl]pentanoate |
| SMILES | CCOC(=O)CC(CC)(CC)c1ccc(N(CC)C2CCOCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H34N2O5/c1-5-22(6-2,16-21(25)29-8-4)17-9-10-19(20(15-17)24(26)27)23(7-3)18-11-13-28-14-12-18/h9-10,15,18H,5-8,11-14,16H2,1-4H3 |
| InChIKey | AWMSZBROWHASCM-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|