C20H31BN2O6 — CID 140744471
1-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-2-nitro-N-(oxan-4-yl)anilino]-2-methylpropan-2-ol (PubChem CID 140744471) has the molecular formula C20H31BN2O6 and a molecular weight of 406.29 g/mol. Its IUPAC name is 1-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-2-nitro-N-(oxan-4-yl)anilino]-2-methylpropan-2-ol.
| Compound Name | 1-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-2-nitro-N-(oxan-4-yl)anilino]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 140744471 |
| Molecular Formula | C20H31BN2O6 |
| Molecular Weight | 406.29 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | 1-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-2-nitro-N-(oxan-4-yl)anilino]-2-methylpropan-2-ol |
| SMILES | CC(C)(O)CN(c1ccc(B2OCC(C)(C)CO2)cc1[N+](=O)[O-])C1CCOCC1 |
| InChI | InChI=1S/C20H31BN2O6/c1-19(2)13-28-21(29-14-19)15-5-6-17(18(11-15)23(25)26)22(12-20(3,4)24)16-7-9-27-10-8-16/h5-6,11,16,24H,7-10,12-14H2,1-4H3 |
| InChIKey | AOCHTZLSUDZAIQ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.29 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|