C11H13BFNO4 — CID 58688030
2-(2-fluoro-3-nitrophenyl)-5,5-dimethyl-1,3,2-dioxaborinane (PubChem CID 58688030) has the molecular formula C11H13BFNO4 and a molecular weight of 253.04 g/mol. Its IUPAC name is 2-(2-fluoro-3-nitrophenyl)-5,5-dimethyl-1,3,2-dioxaborinane.
| Compound Name | 2-(2-fluoro-3-nitrophenyl)-5,5-dimethyl-1,3,2-dioxaborinane |
|---|---|
| PubChem CID | 58688030 |
| Molecular Formula | C11H13BFNO4 |
| Molecular Weight | 253.04 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 2-(2-fluoro-3-nitrophenyl)-5,5-dimethyl-1,3,2-dioxaborinane |
| SMILES | CC1(C)COB(c2cccc([N+](=O)[O-])c2F)OC1 |
| InChI | InChI=1S/C11H13BFNO4/c1-11(2)6-17-12(18-7-11)8-4-3-5-9(10(8)13)14(15)16/h3-5H,6-7H2,1-2H3 |
| InChIKey | DSYSZMWZHKQGHY-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.04 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|