C12H14N2O6 — CID 125483526
2-(2,4-dinitrophenyl)-5,5-dimethyl-1,3-dioxane (PubChem CID 125483526) has the molecular formula C12H14N2O6 and a molecular weight of 282.25 g/mol. Its IUPAC name is 2-(2,4-dinitrophenyl)-5,5-dimethyl-1,3-dioxane.
| Compound Name | 2-(2,4-dinitrophenyl)-5,5-dimethyl-1,3-dioxane |
|---|---|
| PubChem CID | 125483526 |
| Molecular Formula | C12H14N2O6 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 2-(2,4-dinitrophenyl)-5,5-dimethyl-1,3-dioxane |
| SMILES | CC1(C)COC(c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])OC1 |
| InChI | InChI=1S/C12H14N2O6/c1-12(2)6-19-11(20-7-12)9-4-3-8(13(15)16)5-10(9)14(17)18/h3-5,11H,6-7H2,1-2H3 |
| InChIKey | SDDQRPXJJDVIHL-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 104.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|