C11H14NO4P — CID 91045358
5,5-dimethyl-2-(4-nitrophenyl)-1,3,2-dioxaphosphinane (PubChem CID 91045358) has the molecular formula C11H14NO4P and a molecular weight of 255.21 g/mol. Its IUPAC name is 5,5-dimethyl-2-(4-nitrophenyl)-1,3,2-dioxaphosphinane.
| Compound Name | 5,5-dimethyl-2-(4-nitrophenyl)-1,3,2-dioxaphosphinane |
|---|---|
| PubChem CID | 91045358 |
| Molecular Formula | C11H14NO4P |
| Molecular Weight | 255.21 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 5,5-dimethyl-2-(4-nitrophenyl)-1,3,2-dioxaphosphinane |
| SMILES | CC1(C)COP(c2ccc([N+](=O)[O-])cc2)OC1 |
| InChI | InChI=1S/C11H14NO4P/c1-11(2)7-15-17(16-8-11)10-5-3-9(4-6-10)12(13)14/h3-6H,7-8H2,1-2H3 |
| InChIKey | GLPGCFKMGBKXNI-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.21 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|