C12H14NO6PSe — CID 102161031
(5,5-dimethyl-2-selanylidene-1,3,2λ5-dioxaphosphinan-2-yl) 4-nitrobenzoate (PubChem CID 102161031) has the molecular formula C12H14NO6PSe and a molecular weight of 378.18 g/mol. Its IUPAC name is (5,5-dimethyl-2-selanylidene-1,3,2λ5-dioxaphosphinan-2-yl) 4-nitrobenzoate.
| Compound Name | (5,5-dimethyl-2-selanylidene-1,3,2λ5-dioxaphosphinan-2-yl) 4-nitrobenzoate |
|---|---|
| PubChem CID | 102161031 |
| Molecular Formula | C12H14NO6PSe |
| Molecular Weight | 378.18 g/mol |
| Exact Mass | 378.97 |
| IUPAC Name | (5,5-dimethyl-2-selanylidene-1,3,2λ5-dioxaphosphinan-2-yl) 4-nitrobenzoate |
| SMILES | CC1(C)COP(=[Se])(OC(=O)c2ccc([N+](=O)[O-])cc2)OC1 |
| InChI | InChI=1S/C12H14NO6PSe/c1-12(2)7-17-20(21,18-8-12)19-11(14)9-3-5-10(6-4-9)13(15)16/h3-6H,7-8H2,1-2H3 |
| InChIKey | LFCPSAZRZDHRKP-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.18 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|