C10H11NO7S — CID 23272938
[2-(1,3-dioxolan-2-yl)-4-nitrophenyl] methanesulfonate (PubChem CID 23272938) has the molecular formula C10H11NO7S and a molecular weight of 289.26 g/mol. Its IUPAC name is [2-(1,3-dioxolan-2-yl)-4-nitrophenyl] methanesulfonate.
| Compound Name | [2-(1,3-dioxolan-2-yl)-4-nitrophenyl] methanesulfonate |
|---|---|
| PubChem CID | 23272938 |
| Molecular Formula | C10H11NO7S |
| Molecular Weight | 289.26 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | [2-(1,3-dioxolan-2-yl)-4-nitrophenyl] methanesulfonate |
| SMILES | CS(=O)(=O)Oc1ccc([N+](=O)[O-])cc1C1OCCO1 |
| InChI | InChI=1S/C10H11NO7S/c1-19(14,15)18-9-3-2-7(11(12)13)6-8(9)10-16-4-5-17-10/h2-3,6,10H,4-5H2,1H3 |
| InChIKey | NHCZUTDNCOPKCQ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.26 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|