C15H21FN2O2 — CID 107349277
N-[(2-fluoro-3-nitrophenyl)methyl]-1-(2,2,3,3-tetramethylcyclopropyl)methanamine (PubChem CID 107349277) has the molecular formula C15H21FN2O2 and a molecular weight of 280.34 g/mol. Its IUPAC name is N-[(2-fluoro-3-nitrophenyl)methyl]-1-(2,2,3,3-tetramethylcyclopropyl)methanamine.
| Compound Name | N-[(2-fluoro-3-nitrophenyl)methyl]-1-(2,2,3,3-tetramethylcyclopropyl)methanamine |
|---|---|
| PubChem CID | 107349277 |
| Molecular Formula | C15H21FN2O2 |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | N-[(2-fluoro-3-nitrophenyl)methyl]-1-(2,2,3,3-tetramethylcyclopropyl)methanamine |
| SMILES | CC1(C)C(CNCc2cccc([N+](=O)[O-])c2F)C1(C)C |
| InChI | InChI=1S/C15H21FN2O2/c1-14(2)12(15(14,3)4)9-17-8-10-6-5-7-11(13(10)16)18(19)20/h5-7,12,17H,8-9H2,1-4H3 |
| InChIKey | OFSJSZNDXZWCMR-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|