C11H15FN2O3 — CID 107349234
1-[(2-fluoro-3-nitrophenyl)methylamino]-2-methylpropan-2-ol (PubChem CID 107349234) has the molecular formula C11H15FN2O3 and a molecular weight of 242.25 g/mol. Its IUPAC name is 1-[(2-fluoro-3-nitrophenyl)methylamino]-2-methylpropan-2-ol.
| Compound Name | 1-[(2-fluoro-3-nitrophenyl)methylamino]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 107349234 |
| Molecular Formula | C11H15FN2O3 |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 1-[(2-fluoro-3-nitrophenyl)methylamino]-2-methylpropan-2-ol |
| SMILES | CC(C)(O)CNCc1cccc([N+](=O)[O-])c1F |
| InChI | InChI=1S/C11H15FN2O3/c1-11(2,15)7-13-6-8-4-3-5-9(10(8)12)14(16)17/h3-5,13,15H,6-7H2,1-2H3 |
| InChIKey | VEEGMYPFFVQKLU-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|