C19H30BFN2O4 — CID 140744588
4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-2-fluoro-N,N-bis(2-methylpropyl)-6-nitroaniline (PubChem CID 140744588) has the molecular formula C19H30BFN2O4 and a molecular weight of 380.27 g/mol. Its IUPAC name is 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-2-fluoro-N,N-bis(2-methylpropyl)-6-nitroaniline.
| Compound Name | 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-2-fluoro-N,N-bis(2-methylpropyl)-6-nitroaniline |
|---|---|
| PubChem CID | 140744588 |
| Molecular Formula | C19H30BFN2O4 |
| Molecular Weight | 380.27 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-2-fluoro-N,N-bis(2-methylpropyl)-6-nitroaniline |
| SMILES | CC(C)CN(CC(C)C)c1c(F)cc(B2OCC(C)(C)CO2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H30BFN2O4/c1-13(2)9-22(10-14(3)4)18-16(21)7-15(8-17(18)23(24)25)20-26-11-19(5,6)12-27-20/h7-8,13-14H,9-12H2,1-6H3 |
| InChIKey | CVIKAGJWPSMYBK-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.27 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|