C21H32BFN2O4 — CID 140744477
N-cyclohexyl-4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-2-fluoro-N-(2-methylpropyl)-6-nitroaniline (PubChem CID 140744477) has the molecular formula C21H32BFN2O4 and a molecular weight of 406.31 g/mol. Its IUPAC name is N-cyclohexyl-4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-2-fluoro-N-(2-methylpropyl)-6-nitroaniline.
| Compound Name | N-cyclohexyl-4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-2-fluoro-N-(2-methylpropyl)-6-nitroaniline |
|---|---|
| PubChem CID | 140744477 |
| Molecular Formula | C21H32BFN2O4 |
| Molecular Weight | 406.31 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | N-cyclohexyl-4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-2-fluoro-N-(2-methylpropyl)-6-nitroaniline |
| SMILES | CC(C)CN(c1c(F)cc(B2OCC(C)(C)CO2)cc1[N+](=O)[O-])C1CCCCC1 |
| InChI | InChI=1S/C21H32BFN2O4/c1-15(2)12-24(17-8-6-5-7-9-17)20-18(23)10-16(11-19(20)25(26)27)22-28-13-21(3,4)14-29-22/h10-11,15,17H,5-9,12-14H2,1-4H3 |
| InChIKey | GSWHVOKMIJCWRY-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.31 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|