C21H34BFN2O2 — CID 131745682
1-N-cyclohexyl-4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-5-fluoro-1-N-(2-methylpropyl)benzene-1,2-diamine (PubChem CID 131745682) has the molecular formula C21H34BFN2O2 and a molecular weight of 376.33 g/mol. Its IUPAC name is 1-N-cyclohexyl-4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-5-fluoro-1-N-(2-methylpropyl)benzene-1,2-diamine.
| Compound Name | 1-N-cyclohexyl-4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-5-fluoro-1-N-(2-methylpropyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 131745682 |
| Molecular Formula | C21H34BFN2O2 |
| Molecular Weight | 376.33 g/mol |
| Exact Mass | 376.27 |
| IUPAC Name | 1-N-cyclohexyl-4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-5-fluoro-1-N-(2-methylpropyl)benzene-1,2-diamine |
| SMILES | CC(C)CN(c1cc(F)c(B2OCC(C)(C)CO2)cc1N)C1CCCCC1 |
| InChI | InChI=1S/C21H34BFN2O2/c1-15(2)12-25(16-8-6-5-7-9-16)20-11-18(23)17(10-19(20)24)22-26-13-21(3,4)14-27-22/h10-11,15-16H,5-9,12-14,24H2,1-4H3 |
| InChIKey | FNXQRVBBZJFKBB-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.33 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|