C16H22FN3O2 — CID 153448567
2-fluoro-4-(isocyanomethyl)-N,N-bis(2-methylpropyl)-6-nitroaniline (PubChem CID 153448567) has the molecular formula C16H22FN3O2 and a molecular weight of 307.37 g/mol. Its IUPAC name is 2-fluoro-4-(isocyanomethyl)-N,N-bis(2-methylpropyl)-6-nitroaniline.
| Compound Name | 2-fluoro-4-(isocyanomethyl)-N,N-bis(2-methylpropyl)-6-nitroaniline |
|---|---|
| PubChem CID | 153448567 |
| Molecular Formula | C16H22FN3O2 |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 2-fluoro-4-(isocyanomethyl)-N,N-bis(2-methylpropyl)-6-nitroaniline |
| SMILES | [C-]#[N+]Cc1cc(F)c(N(CC(C)C)CC(C)C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H22FN3O2/c1-11(2)9-19(10-12(3)4)16-14(17)6-13(8-18-5)7-15(16)20(21)22/h6-7,11-12H,8-10H2,1-4H3 |
| InChIKey | PSHRARVGMPHUKQ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 50.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|