C27H46N2O5Si — CID 156632513
methyl 3-[4-[[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-(2-methylpropyl)amino]-3-nitrophenyl]butanoate (PubChem CID 156632513) has the molecular formula C27H46N2O5Si and a molecular weight of 506.76 g/mol. Its IUPAC name is methyl 3-[4-[[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-(2-methylpropyl)amino]-3-nitrophenyl]butanoate.
| Compound Name | methyl 3-[4-[[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-(2-methylpropyl)amino]-3-nitrophenyl]butanoate |
|---|---|
| PubChem CID | 156632513 |
| Molecular Formula | C27H46N2O5Si |
| Molecular Weight | 506.76 g/mol |
| Exact Mass | 506.32 |
| IUPAC Name | methyl 3-[4-[[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-(2-methylpropyl)amino]-3-nitrophenyl]butanoate |
| SMILES | COC(=O)CC(C)c1ccc(N(CC(C)C)C2CCC(O[Si](C)(C)C(C)(C)C)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H46N2O5Si/c1-19(2)18-28(22-11-13-23(14-12-22)34-35(8,9)27(4,5)6)24-15-10-21(17-25(24)29(31)32)20(3)16-26(30)33-7/h10,15,17,19-20,22-23H,11-14,16,18H2,1-9H3 |
| InChIKey | ZYHIEAWXUNCSKS-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.76 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|