C19H27FN2O4 — CID 122587326
methyl 3-[4-[(2S)-2-(2-fluoropropan-2-yl)pyrrolidin-1-yl]-3-nitrophenyl]pentanoate (PubChem CID 122587326) has the molecular formula C19H27FN2O4 and a molecular weight of 366.43 g/mol. Its IUPAC name is methyl 3-[4-[(2S)-2-(2-fluoropropan-2-yl)pyrrolidin-1-yl]-3-nitrophenyl]pentanoate.
| Compound Name | methyl 3-[4-[(2S)-2-(2-fluoropropan-2-yl)pyrrolidin-1-yl]-3-nitrophenyl]pentanoate |
|---|---|
| PubChem CID | 122587326 |
| Molecular Formula | C19H27FN2O4 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | methyl 3-[4-[(2S)-2-(2-fluoropropan-2-yl)pyrrolidin-1-yl]-3-nitrophenyl]pentanoate |
| SMILES | CCC(CC(=O)OC)c1ccc(N2CCC[C@H]2C(C)(C)F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H27FN2O4/c1-5-13(12-18(23)26-4)14-8-9-15(16(11-14)22(24)25)21-10-6-7-17(21)19(2,3)20/h8-9,11,13,17H,5-7,10,12H2,1-4H3/t13?,17-/m0/s1 |
| InChIKey | IWHNJESBBAYBAY-RUINGEJQSA-N |
| XLogP | 4.37 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|