C18H26N2O5 — CID 122586242
methyl 3-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-nitrophenyl]pentanoate (PubChem CID 122586242) has the molecular formula C18H26N2O5 and a molecular weight of 350.42 g/mol. Its IUPAC name is methyl 3-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-nitrophenyl]pentanoate.
| Compound Name | methyl 3-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-nitrophenyl]pentanoate |
|---|---|
| PubChem CID | 122586242 |
| Molecular Formula | C18H26N2O5 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | methyl 3-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-nitrophenyl]pentanoate |
| SMILES | CCC(CC(=O)OC)c1ccc(N2C[C@@H](C)O[C@@H](C)C2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H26N2O5/c1-5-14(9-18(21)24-4)15-6-7-16(17(8-15)20(22)23)19-10-12(2)25-13(3)11-19/h6-8,12-14H,5,9-11H2,1-4H3/t12-,13+,14? |
| InChIKey | WRXADIFZPWHMLH-PBWFPOADSA-N |
| XLogP | 3.27 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|