C22H31N3O7 — CID 140744553
tert-butyl (1S,4S)-5-[4-(1,4-dimethoxy-4-oxobutan-2-yl)-2-nitrophenyl]-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 140744553) has the molecular formula C22H31N3O7 and a molecular weight of 449.50 g/mol. Its IUPAC name is tert-butyl (1S,4S)-5-[4-(1,4-dimethoxy-4-oxobutan-2-yl)-2-nitrophenyl]-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | tert-butyl (1S,4S)-5-[4-(1,4-dimethoxy-4-oxobutan-2-yl)-2-nitrophenyl]-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 140744553 |
| Molecular Formula | C22H31N3O7 |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | tert-butyl (1S,4S)-5-[4-(1,4-dimethoxy-4-oxobutan-2-yl)-2-nitrophenyl]-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | COCC(CC(=O)OC)c1ccc(N2C[C@@H]3C[C@H]2CN3C(=O)OC(C)(C)C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H31N3O7/c1-22(2,3)32-21(27)24-12-16-10-17(24)11-23(16)18-7-6-14(8-19(18)25(28)29)15(13-30-4)9-20(26)31-5/h6-8,15-17H,9-13H2,1-5H3/t15?,16-,17-/m0/s1 |
| InChIKey | MXFNYJWNWXRSGB-BSOSBYQFSA-N |
| XLogP | 3.09 |
| TPSA | 111.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|