C14H15F3N2O4 — CID 2973407
ethyl 1-[2-nitro-4-(trifluoromethyl)phenyl]pyrrolidine-2-carboxylate (PubChem CID 2973407) has the molecular formula C14H15F3N2O4 and a molecular weight of 332.28 g/mol. Its IUPAC name is ethyl 1-[2-nitro-4-(trifluoromethyl)phenyl]pyrrolidine-2-carboxylate.
| Compound Name | ethyl 1-[2-nitro-4-(trifluoromethyl)phenyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 2973407 |
| Molecular Formula | C14H15F3N2O4 |
| Molecular Weight | 332.28 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | ethyl 1-[2-nitro-4-(trifluoromethyl)phenyl]pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)C1CCCN1c1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H15F3N2O4/c1-2-23-13(20)11-4-3-7-18(11)10-6-5-9(14(15,16)17)8-12(10)19(21)22/h5-6,8,11H,2-4,7H2,1H3 |
| InChIKey | ODCUIOFKPNKVME-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.28 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|