C12H10F3N2O4- — CID 7200490
(2R)-1-[2-nitro-4-(trifluoromethyl)phenyl]pyrrolidine-2-carboxylate (PubChem CID 7200490) has the molecular formula C12H10F3N2O4- and a molecular weight of 303.22 g/mol. Its IUPAC name is (2R)-1-[2-nitro-4-(trifluoromethyl)phenyl]pyrrolidine-2-carboxylate.
| Compound Name | (2R)-1-[2-nitro-4-(trifluoromethyl)phenyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 7200490 |
| Molecular Formula | C12H10F3N2O4- |
| Molecular Weight | 303.22 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | (2R)-1-[2-nitro-4-(trifluoromethyl)phenyl]pyrrolidine-2-carboxylate |
| SMILES | O=C([O-])[C@H]1CCCN1c1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H11F3N2O4/c13-12(14,15)7-3-4-8(10(6-7)17(20)21)16-5-1-2-9(16)11(18)19/h3-4,6,9H,1-2,5H2,(H,18,19)/p-1/t9-/m1/s1 |
| InChIKey | HCNDRCXDWXUIPG-SECBINFHSA-M |
| XLogP | 1.33 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.22 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|