C30H33F3N2OS — CID 15150393
N-phenyl-4-(trifluoromethyl)-N-(4,7,7-trimethyl-3-piperidin-1-ylbicyclo[2.2.1]hept-2-ene-2-carbothioyl)benzamide (PubChem CID 15150393) has the molecular formula C30H33F3N2OS and a molecular weight of 526.67 g/mol. Its IUPAC name is N-phenyl-4-(trifluoromethyl)-N-(4,7,7-trimethyl-3-piperidin-1-ylbicyclo[2.2.1]hept-2-ene-2-carbothioyl)benzamide.
| Compound Name | N-phenyl-4-(trifluoromethyl)-N-(4,7,7-trimethyl-3-piperidin-1-ylbicyclo[2.2.1]hept-2-ene-2-carbothioyl)benzamide |
|---|---|
| PubChem CID | 15150393 |
| Molecular Formula | C30H33F3N2OS |
| Molecular Weight | 526.67 g/mol |
| Exact Mass | 526.23 |
| IUPAC Name | N-phenyl-4-(trifluoromethyl)-N-(4,7,7-trimethyl-3-piperidin-1-ylbicyclo[2.2.1]hept-2-ene-2-carbothioyl)benzamide |
| SMILES | CC12CCC(C(C(=S)N(C(=O)c3ccc(C(F)(F)F)cc3)c3ccccc3)=C1N1CCCCC1)C2(C)C |
| InChI | InChI=1S/C30H33F3N2OS/c1-28(2)23-16-17-29(28,3)25(34-18-8-5-9-19-34)24(23)27(37)35(22-10-6-4-7-11-22)26(36)20-12-14-21(15-13-20)30(31,32)33/h4,6-7,10-15,23H,5,8-9,16-19H2,1-3H3 |
| InChIKey | OUCJTLPEFJSULB-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.67 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|