C12H16FN — CID 139617902
N-cyclohexyl-N-fluoroaniline (PubChem CID 139617902) has the molecular formula C12H16FN and a molecular weight of 193.27 g/mol. Its IUPAC name is N-cyclohexyl-N-fluoroaniline.
| Compound Name | N-cyclohexyl-N-fluoroaniline |
|---|---|
| PubChem CID | 139617902 |
| Molecular Formula | C12H16FN |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | N-cyclohexyl-N-fluoroaniline |
| SMILES | FN(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C12H16FN/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1,3-4,7-8,12H,2,5-6,9-10H2 |
| InChIKey | YPUQAZWBKWZTGO-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|