C26H40N2Si2 — CID 123743230
N-cyclohexyl-N-[2-(N-cyclohexylanilino)silylethylsilyl]aniline (PubChem CID 123743230) has the molecular formula C26H40N2Si2 and a molecular weight of 436.79 g/mol. Its IUPAC name is N-cyclohexyl-N-[2-(N-cyclohexylanilino)silylethylsilyl]aniline.
| Compound Name | N-cyclohexyl-N-[2-(N-cyclohexylanilino)silylethylsilyl]aniline |
|---|---|
| PubChem CID | 123743230 |
| Molecular Formula | C26H40N2Si2 |
| Molecular Weight | 436.79 g/mol |
| Exact Mass | 436.27 |
| IUPAC Name | N-cyclohexyl-N-[2-(N-cyclohexylanilino)silylethylsilyl]aniline |
| SMILES | c1ccc(N([SiH2]CC[SiH2]N(c2ccccc2)C2CCCCC2)C2CCCCC2)cc1 |
| InChI | InChI=1S/C26H40N2Si2/c1-5-13-23(14-6-1)27(24-15-7-2-8-16-24)29-21-22-30-28(25-17-9-3-10-18-25)26-19-11-4-12-20-26/h1,3,5-6,9-10,13-14,17-18,24,26H,2,4,7-8,11-12,15-16,19-22,29-30H2 |
| InChIKey | PXFYQKOFWINBNV-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.79 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|