C25H38N2Si2 — CID 123940433
N-cyclohexyl-N-[(N-cyclohexylanilino)silylmethylsilyl]aniline (PubChem CID 123940433) has the molecular formula C25H38N2Si2 and a molecular weight of 422.76 g/mol. Its IUPAC name is N-cyclohexyl-N-[(N-cyclohexylanilino)silylmethylsilyl]aniline.
| Compound Name | N-cyclohexyl-N-[(N-cyclohexylanilino)silylmethylsilyl]aniline |
|---|---|
| PubChem CID | 123940433 |
| Molecular Formula | C25H38N2Si2 |
| Molecular Weight | 422.76 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | N-cyclohexyl-N-[(N-cyclohexylanilino)silylmethylsilyl]aniline |
| SMILES | c1ccc(N([SiH2]C[SiH2]N(c2ccccc2)C2CCCCC2)C2CCCCC2)cc1 |
| InChI | InChI=1S/C25H38N2Si2/c1-5-13-22(14-6-1)26(23-15-7-2-8-16-23)28-21-29-27(24-17-9-3-10-18-24)25-19-11-4-12-20-25/h1,3,5-6,9-10,13-14,17-18,23,25H,2,4,7-8,11-12,15-16,19-21,28-29H2 |
| InChIKey | RCSPDIIGOFSWFY-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.76 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|