C19H28N2 — CID 162716598
N,N'-dicyclohexyl-N-phenylmethanimidamide (PubChem CID 162716598) has the molecular formula C19H28N2 and a molecular weight of 284.45 g/mol. Its IUPAC name is N,N'-dicyclohexyl-N-phenylmethanimidamide.
| Compound Name | N,N'-dicyclohexyl-N-phenylmethanimidamide |
|---|---|
| PubChem CID | 162716598 |
| Molecular Formula | C19H28N2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.23 |
| IUPAC Name | N,N'-dicyclohexyl-N-phenylmethanimidamide |
| SMILES | C(=N/C1CCCCC1)\N(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C19H28N2/c1-4-10-17(11-5-1)20-16-21(18-12-6-2-7-13-18)19-14-8-3-9-15-19/h2,6-7,12-13,16-17,19H,1,3-5,8-11,14-15H2/b20-16+ |
| InChIKey | KFUSZNYKHRWACU-CAPFRKAQSA-N |
| XLogP | 5.19 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|