C16H32N2Si — CID 86065740
N,N'-dicyclohexyl-N-trimethylsilylmethanimidamide (PubChem CID 86065740) has the molecular formula C16H32N2Si and a molecular weight of 280.53 g/mol. Its IUPAC name is N,N'-dicyclohexyl-N-trimethylsilylmethanimidamide.
| Compound Name | N,N'-dicyclohexyl-N-trimethylsilylmethanimidamide |
|---|---|
| PubChem CID | 86065740 |
| Molecular Formula | C16H32N2Si |
| Molecular Weight | 280.53 g/mol |
| Exact Mass | 280.23 |
| IUPAC Name | N,N'-dicyclohexyl-N-trimethylsilylmethanimidamide |
| SMILES | C[Si](C)(C)N(/C=N/C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C16H32N2Si/c1-19(2,3)18(16-12-8-5-9-13-16)14-17-15-10-6-4-7-11-15/h14-16H,4-13H2,1-3H3/b17-14+ |
| InChIKey | GASPOLXOFDWJRL-SAPNQHFASA-N |
| XLogP | 4.82 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.53 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|