C12H29NSi2 — CID 12571850
N,N-bis(trimethylsilyl)cyclohexanamine (PubChem CID 12571850) has the molecular formula C12H29NSi2 and a molecular weight of 243.54 g/mol. Its IUPAC name is N,N-bis(trimethylsilyl)cyclohexanamine.
| Compound Name | N,N-bis(trimethylsilyl)cyclohexanamine |
|---|---|
| PubChem CID | 12571850 |
| Molecular Formula | C12H29NSi2 |
| Molecular Weight | 243.54 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | N,N-bis(trimethylsilyl)cyclohexanamine |
| SMILES | C[Si](C)(C)N(C1CCCCC1)[Si](C)(C)C |
| InChI | InChI=1S/C12H29NSi2/c1-14(2,3)13(15(4,5)6)12-10-8-7-9-11-12/h12H,7-11H2,1-6H3 |
| InChIKey | OJRGRUJEMUVLAG-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.54 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|