C10H23Cl2NSi2 — CID 176847988
N,N-bis[chloro(dimethyl)silyl]cyclohexanamine (PubChem CID 176847988) has the molecular formula C10H23Cl2NSi2 and a molecular weight of 284.38 g/mol. Its IUPAC name is N,N-bis[chloro(dimethyl)silyl]cyclohexanamine.
| Compound Name | N,N-bis[chloro(dimethyl)silyl]cyclohexanamine |
|---|---|
| PubChem CID | 176847988 |
| Molecular Formula | C10H23Cl2NSi2 |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | N,N-bis[chloro(dimethyl)silyl]cyclohexanamine |
| SMILES | C[Si](C)(Cl)N(C1CCCCC1)[Si](C)(C)Cl |
| InChI | InChI=1S/C10H23Cl2NSi2/c1-14(2,11)13(15(3,4)12)10-8-6-5-7-9-10/h10H,5-9H2,1-4H3 |
| InChIKey | DPDWKSJLQKPHMV-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|