C11H16Cl2N4 — CID 81037778
3,6-dichloro-N-cycloheptyl-N-methyl-1,2,4-triazin-5-amine (PubChem CID 81037778) has the molecular formula C11H16Cl2N4 and a molecular weight of 275.18 g/mol. Its IUPAC name is 3,6-dichloro-N-cycloheptyl-N-methyl-1,2,4-triazin-5-amine.
| Compound Name | 3,6-dichloro-N-cycloheptyl-N-methyl-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 81037778 |
| Molecular Formula | C11H16Cl2N4 |
| Molecular Weight | 275.18 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 3,6-dichloro-N-cycloheptyl-N-methyl-1,2,4-triazin-5-amine |
| SMILES | CN(c1nc(Cl)nnc1Cl)C1CCCCCC1 |
| InChI | InChI=1S/C11H16Cl2N4/c1-17(8-6-4-2-3-5-7-8)10-9(12)15-16-11(13)14-10/h8H,2-7H2,1H3 |
| InChIKey | BKDRBSKLBUXQJD-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.18 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |