C10H13Cl2N3 — CID 130569686
2,6-dichloro-N-cyclopentyl-N-methylpyrimidin-4-amine (PubChem CID 130569686) has the molecular formula C10H13Cl2N3 and a molecular weight of 246.14 g/mol. Its IUPAC name is 2,6-dichloro-N-cyclopentyl-N-methylpyrimidin-4-amine.
| Compound Name | 2,6-dichloro-N-cyclopentyl-N-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 130569686 |
| Molecular Formula | C10H13Cl2N3 |
| Molecular Weight | 246.14 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 2,6-dichloro-N-cyclopentyl-N-methylpyrimidin-4-amine |
| SMILES | CN(c1cc(Cl)nc(Cl)n1)C1CCCC1 |
| InChI | InChI=1S/C10H13Cl2N3/c1-15(7-4-2-3-5-7)9-6-8(11)13-10(12)14-9/h6-7H,2-5H2,1H3 |
| InChIKey | URYWQIIEBDCEPU-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.14 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |