C10H11ClF3N3 — CID 114562925
2-chloro-N-cyclobutyl-N-methyl-6-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 114562925) has the molecular formula C10H11ClF3N3 and a molecular weight of 265.67 g/mol. Its IUPAC name is 2-chloro-N-cyclobutyl-N-methyl-6-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | 2-chloro-N-cyclobutyl-N-methyl-6-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 114562925 |
| Molecular Formula | C10H11ClF3N3 |
| Molecular Weight | 265.67 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | 2-chloro-N-cyclobutyl-N-methyl-6-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | CN(c1cc(C(F)(F)F)nc(Cl)n1)C1CCC1 |
| InChI | InChI=1S/C10H11ClF3N3/c1-17(6-3-2-4-6)8-5-7(10(12,13)14)15-9(11)16-8/h5-6H,2-4H2,1H3 |
| InChIKey | RHGAHPYXUBXJJT-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.67 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |