C12H15ClF3N3O — CID 114951014
1-[[[2-chloro-6-(trifluoromethyl)pyrimidin-4-yl]-methylamino]methyl]cyclopentan-1-ol (PubChem CID 114951014) has the molecular formula C12H15ClF3N3O and a molecular weight of 309.72 g/mol. Its IUPAC name is 1-[[[2-chloro-6-(trifluoromethyl)pyrimidin-4-yl]-methylamino]methyl]cyclopentan-1-ol.
| Compound Name | 1-[[[2-chloro-6-(trifluoromethyl)pyrimidin-4-yl]-methylamino]methyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 114951014 |
| Molecular Formula | C12H15ClF3N3O |
| Molecular Weight | 309.72 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 1-[[[2-chloro-6-(trifluoromethyl)pyrimidin-4-yl]-methylamino]methyl]cyclopentan-1-ol |
| SMILES | CN(CC1(O)CCCC1)c1cc(C(F)(F)F)nc(Cl)n1 |
| InChI | InChI=1S/C12H15ClF3N3O/c1-19(7-11(20)4-2-3-5-11)9-6-8(12(14,15)16)17-10(13)18-9/h6,20H,2-5,7H2,1H3 |
| InChIKey | PWCDYKHUIDCFMA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.72 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |