C12H20N4 — CID 80774637
4-N-cyclopentyl-4-N,6-N,2-trimethylpyrimidine-4,6-diamine (PubChem CID 80774637) has the molecular formula C12H20N4 and a molecular weight of 220.32 g/mol. Its IUPAC name is 4-N-cyclopentyl-4-N,6-N,2-trimethylpyrimidine-4,6-diamine.
| Compound Name | 4-N-cyclopentyl-4-N,6-N,2-trimethylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80774637 |
| Molecular Formula | C12H20N4 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.17 |
| IUPAC Name | 4-N-cyclopentyl-4-N,6-N,2-trimethylpyrimidine-4,6-diamine |
| SMILES | CNc1cc(N(C)C2CCCC2)nc(C)n1 |
| InChI | InChI=1S/C12H20N4/c1-9-14-11(13-2)8-12(15-9)16(3)10-6-4-5-7-10/h8,10H,4-7H2,1-3H3,(H,13,14,15) |
| InChIKey | DNQRNXFFDPRFOC-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |