C12H22N6 — CID 80899128
4-N-cycloheptyl-6-hydrazinyl-4-N-methylpyrimidine-2,4-diamine (PubChem CID 80899128) has the molecular formula C12H22N6 and a molecular weight of 250.35 g/mol. Its IUPAC name is 4-N-cycloheptyl-6-hydrazinyl-4-N-methylpyrimidine-2,4-diamine.
| Compound Name | 4-N-cycloheptyl-6-hydrazinyl-4-N-methylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80899128 |
| Molecular Formula | C12H22N6 |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 4-N-cycloheptyl-6-hydrazinyl-4-N-methylpyrimidine-2,4-diamine |
| SMILES | CN(c1cc(NN)nc(N)n1)C1CCCCCC1 |
| InChI | InChI=1S/C12H22N6/c1-18(9-6-4-2-3-5-7-9)11-8-10(17-14)15-12(13)16-11/h8-9H,2-7,14H2,1H3,(H3,13,15,16,17) |
| InChIKey | NHADMTUCODRNSR-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|