C12H21N5 — CID 80788881
4-N-cycloheptyl-4-N-methylpyrimidine-2,4,6-triamine (PubChem CID 80788881) has the molecular formula C12H21N5 and a molecular weight of 235.33 g/mol. Its IUPAC name is 4-N-cycloheptyl-4-N-methylpyrimidine-2,4,6-triamine.
| Compound Name | 4-N-cycloheptyl-4-N-methylpyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 80788881 |
| Molecular Formula | C12H21N5 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.18 |
| IUPAC Name | 4-N-cycloheptyl-4-N-methylpyrimidine-2,4,6-triamine |
| SMILES | CN(c1cc(N)nc(N)n1)C1CCCCCC1 |
| InChI | InChI=1S/C12H21N5/c1-17(9-6-4-2-3-5-7-9)11-8-10(13)15-12(14)16-11/h8-9H,2-7H2,1H3,(H4,13,14,15,16) |
| InChIKey | KSYPWAZGSUYHIF-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |