C12H21N5O — CID 80810818
2-[cyclohexyl-(2,6-diaminopyrimidin-4-yl)amino]ethanol (PubChem CID 80810818) has the molecular formula C12H21N5O and a molecular weight of 251.33 g/mol. Its IUPAC name is 2-[cyclohexyl-(2,6-diaminopyrimidin-4-yl)amino]ethanol.
| Compound Name | 2-[cyclohexyl-(2,6-diaminopyrimidin-4-yl)amino]ethanol |
|---|---|
| PubChem CID | 80810818 |
| Molecular Formula | C12H21N5O |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 2-[cyclohexyl-(2,6-diaminopyrimidin-4-yl)amino]ethanol |
| SMILES | Nc1cc(N(CCO)C2CCCCC2)nc(N)n1 |
| InChI | InChI=1S/C12H21N5O/c13-10-8-11(16-12(14)15-10)17(6-7-18)9-4-2-1-3-5-9/h8-9,18H,1-7H2,(H4,13,14,15,16) |
| InChIKey | VTDGYMBQMMZAKL-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |