C9H16N6O — CID 80904604
2-[(2-amino-6-hydrazinylpyrimidin-4-yl)-cyclopropylamino]ethanol (PubChem CID 80904604) has the molecular formula C9H16N6O and a molecular weight of 224.27 g/mol. Its IUPAC name is 2-[(2-amino-6-hydrazinylpyrimidin-4-yl)-cyclopropylamino]ethanol.
| Compound Name | 2-[(2-amino-6-hydrazinylpyrimidin-4-yl)-cyclopropylamino]ethanol |
|---|---|
| PubChem CID | 80904604 |
| Molecular Formula | C9H16N6O |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 2-[(2-amino-6-hydrazinylpyrimidin-4-yl)-cyclopropylamino]ethanol |
| SMILES | NNc1cc(N(CCO)C2CC2)nc(N)n1 |
| InChI | InChI=1S/C9H16N6O/c10-9-12-7(14-11)5-8(13-9)15(3-4-16)6-1-2-6/h5-6,16H,1-4,11H2,(H3,10,12,13,14) |
| InChIKey | GMCNBRUPFLEREY-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|