C21H25NO — CID 154142475
3-cyclohexylimino-1,1-diphenylpropan-1-ol (PubChem CID 154142475) has the molecular formula C21H25NO and a molecular weight of 307.44 g/mol. Its IUPAC name is 3-cyclohexylimino-1,1-diphenylpropan-1-ol.
| Compound Name | 3-cyclohexylimino-1,1-diphenylpropan-1-ol |
|---|---|
| PubChem CID | 154142475 |
| Molecular Formula | C21H25NO |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | 3-cyclohexylimino-1,1-diphenylpropan-1-ol |
| SMILES | OC(C/C=N/C1CCCCC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H25NO/c23-21(18-10-4-1-5-11-18,19-12-6-2-7-13-19)16-17-22-20-14-8-3-9-15-20/h1-2,4-7,10-13,17,20,23H,3,8-9,14-16H2/b22-17+ |
| InChIKey | JWPAEJXIYGYYEI-OQKWZONESA-N |
| XLogP | 4.72 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|