C17H26O4 — CID 156850348
1-cyclohexyl-2,2-bis(hydroxymethyl)-1-phenylpropane-1,3-diol (PubChem CID 156850348) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is 1-cyclohexyl-2,2-bis(hydroxymethyl)-1-phenylpropane-1,3-diol.
| Compound Name | 1-cyclohexyl-2,2-bis(hydroxymethyl)-1-phenylpropane-1,3-diol |
|---|---|
| PubChem CID | 156850348 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 1-cyclohexyl-2,2-bis(hydroxymethyl)-1-phenylpropane-1,3-diol |
| SMILES | OCC(CO)(CO)C(O)(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C17H26O4/c18-11-16(12-19,13-20)17(21,14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1,3-4,7-8,15,18-21H,2,5-6,9-13H2 |
| InChIKey | DCLUKNVDNNSHAJ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |