C32H36N2O2 — CID 171577199
N-[2-[benzoyl(cyclohexyl)amino]phenyl]-N-cyclohexylbenzamide (PubChem CID 171577199) has the molecular formula C32H36N2O2 and a molecular weight of 480.65 g/mol. Its IUPAC name is N-[2-[benzoyl(cyclohexyl)amino]phenyl]-N-cyclohexylbenzamide.
| Compound Name | N-[2-[benzoyl(cyclohexyl)amino]phenyl]-N-cyclohexylbenzamide |
|---|---|
| PubChem CID | 171577199 |
| Molecular Formula | C32H36N2O2 |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.28 |
| IUPAC Name | N-[2-[benzoyl(cyclohexyl)amino]phenyl]-N-cyclohexylbenzamide |
| SMILES | O=C(c1ccccc1)N(c1ccccc1N(C(=O)c1ccccc1)C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C32H36N2O2/c35-31(25-15-5-1-6-16-25)33(27-19-9-3-10-20-27)29-23-13-14-24-30(29)34(28-21-11-4-12-22-28)32(36)26-17-7-2-8-18-26/h1-2,5-8,13-18,23-24,27-28H,3-4,9-12,19-22H2 |
| InChIKey | KNAOCFKUPYIGJB-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |