C38H40N2O3 — CID 175598957
N-[3-[3-[benzoyl(cyclohexyl)amino]phenoxy]phenyl]-N-cyclohexylbenzamide (PubChem CID 175598957) has the molecular formula C38H40N2O3 and a molecular weight of 572.75 g/mol. Its IUPAC name is N-[3-[3-[benzoyl(cyclohexyl)amino]phenoxy]phenyl]-N-cyclohexylbenzamide.
| Compound Name | N-[3-[3-[benzoyl(cyclohexyl)amino]phenoxy]phenyl]-N-cyclohexylbenzamide |
|---|---|
| PubChem CID | 175598957 |
| Molecular Formula | C38H40N2O3 |
| Molecular Weight | 572.75 g/mol |
| Exact Mass | 572.30 |
| IUPAC Name | N-[3-[3-[benzoyl(cyclohexyl)amino]phenoxy]phenyl]-N-cyclohexylbenzamide |
| SMILES | O=C(c1ccccc1)N(c1cccc(Oc2cccc(N(C(=O)c3ccccc3)C3CCCCC3)c2)c1)C1CCCCC1 |
| InChI | InChI=1S/C38H40N2O3/c41-37(29-15-5-1-6-16-29)39(31-19-9-3-10-20-31)33-23-13-25-35(27-33)43-36-26-14-24-34(28-36)40(32-21-11-4-12-22-32)38(42)30-17-7-2-8-18-30/h1-2,5-8,13-18,23-28,31-32H,3-4,9-12,19-22H2 |
| InChIKey | WQFQXSKAPICCMY-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.75 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |