C29H33N3O — CID 90892127
N-cyclohexyl-N-[4-(4-phenylpiperazin-1-yl)phenyl]benzamide (PubChem CID 90892127) has the molecular formula C29H33N3O and a molecular weight of 439.60 g/mol. Its IUPAC name is N-cyclohexyl-N-[4-(4-phenylpiperazin-1-yl)phenyl]benzamide.
| Compound Name | N-cyclohexyl-N-[4-(4-phenylpiperazin-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 90892127 |
| Molecular Formula | C29H33N3O |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.26 |
| IUPAC Name | N-cyclohexyl-N-[4-(4-phenylpiperazin-1-yl)phenyl]benzamide |
| SMILES | O=C(c1ccccc1)N(c1ccc(N2CCN(c3ccccc3)CC2)cc1)C1CCCCC1 |
| InChI | InChI=1S/C29H33N3O/c33-29(24-10-4-1-5-11-24)32(27-14-8-3-9-15-27)28-18-16-26(17-19-28)31-22-20-30(21-23-31)25-12-6-2-7-13-25/h1-2,4-7,10-13,16-19,27H,3,8-9,14-15,20-23H2 |
| InChIKey | UMGNRQFEXNDHQY-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|