C26H32N2O2 — CID 170591666
N-cyclohexyl-2-(4-formyl-1-phenylpiperidin-4-yl)-N-phenylacetamide (PubChem CID 170591666) has the molecular formula C26H32N2O2 and a molecular weight of 404.55 g/mol. Its IUPAC name is N-cyclohexyl-2-(4-formyl-1-phenylpiperidin-4-yl)-N-phenylacetamide.
| Compound Name | N-cyclohexyl-2-(4-formyl-1-phenylpiperidin-4-yl)-N-phenylacetamide |
|---|---|
| PubChem CID | 170591666 |
| Molecular Formula | C26H32N2O2 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.25 |
| IUPAC Name | N-cyclohexyl-2-(4-formyl-1-phenylpiperidin-4-yl)-N-phenylacetamide |
| SMILES | O=CC1(CC(=O)N(c2ccccc2)C2CCCCC2)CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C26H32N2O2/c29-21-26(16-18-27(19-17-26)22-10-4-1-5-11-22)20-25(30)28(23-12-6-2-7-13-23)24-14-8-3-9-15-24/h1-2,4-7,10-13,21,24H,3,8-9,14-20H2 |
| InChIKey | RUEVXIKXUMEKNE-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|