C29H36FN3O3 — CID 170414295
4-[2-(N-cyclohexylanilino)-2-oxoethyl]-N-(4-fluorophenyl)-4-(1-hydroxyethenyl)-N-methylpiperidine-1-carboxamide (PubChem CID 170414295) has the molecular formula C29H36FN3O3 and a molecular weight of 493.62 g/mol. Its IUPAC name is 4-[2-(N-cyclohexylanilino)-2-oxoethyl]-N-(4-fluorophenyl)-4-(1-hydroxyethenyl)-N-methylpiperidine-1-carboxamide.
| Compound Name | 4-[2-(N-cyclohexylanilino)-2-oxoethyl]-N-(4-fluorophenyl)-4-(1-hydroxyethenyl)-N-methylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 170414295 |
| Molecular Formula | C29H36FN3O3 |
| Molecular Weight | 493.62 g/mol |
| Exact Mass | 493.27 |
| IUPAC Name | 4-[2-(N-cyclohexylanilino)-2-oxoethyl]-N-(4-fluorophenyl)-4-(1-hydroxyethenyl)-N-methylpiperidine-1-carboxamide |
| SMILES | C=C(O)C1(CC(=O)N(c2ccccc2)C2CCCCC2)CCN(C(=O)N(C)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C29H36FN3O3/c1-22(34)29(17-19-32(20-18-29)28(36)31(2)24-15-13-23(30)14-16-24)21-27(35)33(25-9-5-3-6-10-25)26-11-7-4-8-12-26/h3,5-6,9-10,13-16,26,34H,1,4,7-8,11-12,17-21H2,2H3 |
| InChIKey | KGFLQYKPFXUQPC-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.62 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|