C22H32N2O3 — CID 90738858
1-[1-[[2-(N-cyclohexylanilino)-2-oxoethyl]amino]ethyl]cyclopentane-1-carboxylic acid (PubChem CID 90738858) has the molecular formula C22H32N2O3 and a molecular weight of 372.51 g/mol. Its IUPAC name is 1-[1-[[2-(N-cyclohexylanilino)-2-oxoethyl]amino]ethyl]cyclopentane-1-carboxylic acid.
| Compound Name | 1-[1-[[2-(N-cyclohexylanilino)-2-oxoethyl]amino]ethyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 90738858 |
| Molecular Formula | C22H32N2O3 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | 1-[1-[[2-(N-cyclohexylanilino)-2-oxoethyl]amino]ethyl]cyclopentane-1-carboxylic acid |
| SMILES | CC(NCC(=O)N(c1ccccc1)C1CCCCC1)C1(C(=O)O)CCCC1 |
| InChI | InChI=1S/C22H32N2O3/c1-17(22(21(26)27)14-8-9-15-22)23-16-20(25)24(18-10-4-2-5-11-18)19-12-6-3-7-13-19/h2,4-5,10-11,17,19,23H,3,6-9,12-16H2,1H3,(H,26,27) |
| InChIKey | DERPTVBPLSLWTJ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |