C20H32N3O2+ — CID 9050143
[2-(N-cyclohexylanilino)-2-oxoethyl]-methyl-[2-oxo-2-(propan-2-ylamino)ethyl]azanium (PubChem CID 9050143) has the molecular formula C20H32N3O2+ and a molecular weight of 346.50 g/mol. Its IUPAC name is [2-(N-cyclohexylanilino)-2-oxoethyl]-methyl-[2-oxo-2-(propan-2-ylamino)ethyl]azanium.
| Compound Name | [2-(N-cyclohexylanilino)-2-oxoethyl]-methyl-[2-oxo-2-(propan-2-ylamino)ethyl]azanium |
|---|---|
| PubChem CID | 9050143 |
| Molecular Formula | C20H32N3O2+ |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | [2-(N-cyclohexylanilino)-2-oxoethyl]-methyl-[2-oxo-2-(propan-2-ylamino)ethyl]azanium |
| SMILES | CC(C)NC(=O)C[NH+](C)CC(=O)N(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C20H31N3O2/c1-16(2)21-19(24)14-22(3)15-20(25)23(17-10-6-4-7-11-17)18-12-8-5-9-13-18/h4,6-7,10-11,16,18H,5,8-9,12-15H2,1-3H3,(H,21,24)/p+1 |
| InChIKey | LITHVEGISJMRQX-UHFFFAOYSA-O |
| XLogP | 1.39 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |