C22H36N3OS+ — CID 90948874
[2-(N-cyclohexylanilino)-2-oxoethyl]-(3,3-dimethylbutan-2-yl)-methanethioyl-(methylamino)azanium (PubChem CID 90948874) has the molecular formula C22H36N3OS+ and a molecular weight of 390.62 g/mol. Its IUPAC name is [2-(N-cyclohexylanilino)-2-oxoethyl]-(3,3-dimethylbutan-2-yl)-methanethioyl-(methylamino)azanium.
| Compound Name | [2-(N-cyclohexylanilino)-2-oxoethyl]-(3,3-dimethylbutan-2-yl)-methanethioyl-(methylamino)azanium |
|---|---|
| PubChem CID | 90948874 |
| Molecular Formula | C22H36N3OS+ |
| Molecular Weight | 390.62 g/mol |
| Exact Mass | 390.26 |
| IUPAC Name | [2-(N-cyclohexylanilino)-2-oxoethyl]-(3,3-dimethylbutan-2-yl)-methanethioyl-(methylamino)azanium |
| SMILES | CN[N+](C=S)(CC(=O)N(c1ccccc1)C1CCCCC1)C(C)C(C)(C)C |
| InChI | InChI=1S/C22H36N3OS/c1-18(22(2,3)4)25(17-27,23-5)16-21(26)24(19-12-8-6-9-13-19)20-14-10-7-11-15-20/h6,8-9,12-13,17-18,20,23H,7,10-11,14-16H2,1-5H3/q+1 |
| InChIKey | WRTCDNYQMZWXBM-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.62 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|