C25H36N2O3 — CID 90268724
3-(N-[(1R,5S)-9-cyclooctyl-9-azabicyclo[3.3.1]nonan-3-yl]anilino)-3-oxopropanoic acid (PubChem CID 90268724) has the molecular formula C25H36N2O3 and a molecular weight of 412.57 g/mol. Its IUPAC name is 3-(N-[(1R,5S)-9-cyclooctyl-9-azabicyclo[3.3.1]nonan-3-yl]anilino)-3-oxopropanoic acid.
| Compound Name | 3-(N-[(1R,5S)-9-cyclooctyl-9-azabicyclo[3.3.1]nonan-3-yl]anilino)-3-oxopropanoic acid |
|---|---|
| PubChem CID | 90268724 |
| Molecular Formula | C25H36N2O3 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.27 |
| IUPAC Name | 3-(N-[(1R,5S)-9-cyclooctyl-9-azabicyclo[3.3.1]nonan-3-yl]anilino)-3-oxopropanoic acid |
| SMILES | O=C(O)CC(=O)N(c1ccccc1)C1C[C@H]2CCC[C@@H](C1)N2C1CCCCCCC1 |
| InChI | InChI=1S/C25H36N2O3/c28-24(18-25(29)30)27(20-12-7-4-8-13-20)23-16-21-14-9-15-22(17-23)26(21)19-10-5-2-1-3-6-11-19/h4,7-8,12-13,19,21-23H,1-3,5-6,9-11,14-18H2,(H,29,30)/t21-,22+,23? |
| InChIKey | KQXFIAXWCKSFSC-AIZNXBIQSA-N |
| XLogP | 4.99 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|