C24H37N3O — CID 90268864
N-(2-aminophenyl)-N-[(1S,5R)-9-cyclooctyl-9-azabicyclo[3.3.1]nonan-3-yl]acetamide (PubChem CID 90268864) has the molecular formula C24H37N3O and a molecular weight of 383.58 g/mol. Its IUPAC name is N-(2-aminophenyl)-N-[(1S,5R)-9-cyclooctyl-9-azabicyclo[3.3.1]nonan-3-yl]acetamide.
| Compound Name | N-(2-aminophenyl)-N-[(1S,5R)-9-cyclooctyl-9-azabicyclo[3.3.1]nonan-3-yl]acetamide |
|---|---|
| PubChem CID | 90268864 |
| Molecular Formula | C24H37N3O |
| Molecular Weight | 383.58 g/mol |
| Exact Mass | 383.29 |
| IUPAC Name | N-(2-aminophenyl)-N-[(1S,5R)-9-cyclooctyl-9-azabicyclo[3.3.1]nonan-3-yl]acetamide |
| SMILES | CC(=O)N(c1ccccc1N)C1C[C@H]2CCC[C@@H](C1)N2C1CCCCCCC1 |
| InChI | InChI=1S/C24H37N3O/c1-18(28)26(24-15-8-7-14-23(24)25)22-16-20-12-9-13-21(17-22)27(20)19-10-5-3-2-4-6-11-19/h7-8,14-15,19-22H,2-6,9-13,16-17,25H2,1H3/t20-,21+,22? |
| InChIKey | RRHPMJCJDRWZBP-CBQGHPETSA-N |
| XLogP | 5.12 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.58 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|