About N-(2-aminophenyl)-N-[(1S,5R)-9-cyclooctyl-9-azabicyclo[3.3.1]nonan-3-yl]acetamide
N-(2-aminophenyl)-N-[(1S,5R)-9-cyclooctyl-9-azabicyclo[3.3.1]nonan-3-yl]acetamide (PubChem CID 90268864) has the molecular formula C24H37N3O
and a molecular weight of 383.58 g/mol. Its IUPAC name is N-(2-aminophenyl)-N-[(1S,5R)-9-cyclooctyl-9-azabicyclo[3.3.1]nonan-3-yl]acetamide.
Molecular Properties
| Compound Name | N-(2-aminophenyl)-N-[(1S,5R)-9-cyclooctyl-9-azabicyclo[3.3.1]nonan-3-yl]acetamide |
| PubChem CID | 90268864 |
| Molecular Formula | C24H37N3O |
| Molecular Weight | 383.58 g/mol |
| Exact Mass | 383.29 |
| IUPAC Name | N-(2-aminophenyl)-N-[(1S,5R)-9-cyclooctyl-9-azabicyclo[3.3.1]nonan-3-yl]acetamide |
| SMILES | CC(=O)N(c1ccccc1N)C1C[C@H]2CCC[C@@H](C1)N2C1CCCCCCC1 |
| InChI | InChI=1S/C24H37N3O/c1-18(28)26(24-15-8-7-14-23(24)25)22-16-20-12-9-13-21(17-22)27(20)19-10-5-3-2-4-6-11-19/h7-8,14-15,19-22H,2-6,9-13,16-17,25H2,1H3/t20-,21+,22? |
| InChIKey | RRHPMJCJDRWZBP-CBQGHPETSA-N |
| XLogP | 5.12 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.58 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze N-(2-aminophenyl)-N-[(1S,5R)-9-cyclooctyl-9-azabicyclo[3.3.1]nonan-3-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminophenyl)-N-[(1S,5R)-9-cyclooctyl-9-azabicyclo[3.3.1]nonan-3-yl]acetamide?
The IUPAC name of N-(2-aminophenyl)-N-[(1S,5R)-9-cyclooctyl-9-azabicyclo[3.3.1]nonan-3-yl]acetamide (CID 90268864) is N-(2-aminophenyl)-N-[(1S,5R)-9-cyclooctyl-9-azabicyclo[3.3.1]nonan-3-yl]acetamide.
What is the SMILES notation for N-(2-aminophenyl)-N-[(1S,5R)-9-cyclooctyl-9-azabicyclo[3.3.1]nonan-3-yl]acetamide?
The canonical SMILES for N-(2-aminophenyl)-N-[(1S,5R)-9-cyclooctyl-9-azabicyclo[3.3.1]nonan-3-yl]acetamide is CC(=O)N(c1ccccc1N)C1C[C@H]2CCC[C@@H](C1)N2C1CCCCCCC1.
What is the InChIKey of N-(2-aminophenyl)-N-[(1S,5R)-9-cyclooctyl-9-azabicyclo[3.3.1]nonan-3-yl]acetamide?
The InChIKey is RRHPMJCJDRWZBP-CBQGHPETSA-N. The full InChI is InChI=1S/C24H37N3O/c1-18(28)26(24-15-8-7-14-23(24)25)22-16-20-12-9-13-21(17-22)27(20)19-10-5-3-2-4-6-11-19/h7-8,14-15,19-22H,2-6,9-13,16-17,25H2,1H3/t20-,21+,22?.
What are the key properties of N-(2-aminophenyl)-N-[(1S,5R)-9-cyclooctyl-9-azabicyclo[3.3.1]nonan-3-yl]acetamide?
N-(2-aminophenyl)-N-[(1S,5R)-9-cyclooctyl-9-azabicyclo[3.3.1]nonan-3-yl]acetamide has a molecular weight of 383.58 g/mol, XLogP of 5.12, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminophenyl)-N-[(1S,5R)-9-cyclooctyl-9-azabicyclo[3.3.1]nonan-3-yl]acetamide is sourced from PubChem (CID 90268864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).