C30H41N3O — CID 10139424
4-(N-(8-cyclohexyl-8-azabicyclo[3.2.1]octan-3-yl)anilino)-N,N-diethylbenzamide (PubChem CID 10139424) has the molecular formula C30H41N3O and a molecular weight of 459.68 g/mol. Its IUPAC name is 4-(N-(8-cyclohexyl-8-azabicyclo[3.2.1]octan-3-yl)anilino)-N,N-diethylbenzamide.
| Compound Name | 4-(N-(8-cyclohexyl-8-azabicyclo[3.2.1]octan-3-yl)anilino)-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 10139424 |
| Molecular Formula | C30H41N3O |
| Molecular Weight | 459.68 g/mol |
| Exact Mass | 459.32 |
| IUPAC Name | 4-(N-(8-cyclohexyl-8-azabicyclo[3.2.1]octan-3-yl)anilino)-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(N(c2ccccc2)C2CC3CCC(C2)N3C2CCCCC2)cc1 |
| InChI | InChI=1S/C30H41N3O/c1-3-31(4-2)30(34)23-15-17-26(18-16-23)32(24-11-7-5-8-12-24)29-21-27-19-20-28(22-29)33(27)25-13-9-6-10-14-25/h5,7-8,11-12,15-18,25,27-29H,3-4,6,9-10,13-14,19-22H2,1-2H3 |
| InChIKey | JYOSRCIINPVTSJ-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.68 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |