C26H31N3O — CID 12988887
N,N-diethyl-4-[naphthalen-2-yl(piperidin-4-yl)amino]benzamide (PubChem CID 12988887) has the molecular formula C26H31N3O and a molecular weight of 401.55 g/mol. Its IUPAC name is N,N-diethyl-4-[naphthalen-2-yl(piperidin-4-yl)amino]benzamide.
| Compound Name | N,N-diethyl-4-[naphthalen-2-yl(piperidin-4-yl)amino]benzamide |
|---|---|
| PubChem CID | 12988887 |
| Molecular Formula | C26H31N3O |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.25 |
| IUPAC Name | N,N-diethyl-4-[naphthalen-2-yl(piperidin-4-yl)amino]benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(N(c2ccc3ccccc3c2)C2CCNCC2)cc1 |
| InChI | InChI=1S/C26H31N3O/c1-3-28(4-2)26(30)21-10-12-23(13-11-21)29(24-15-17-27-18-16-24)25-14-9-20-7-5-6-8-22(20)19-25/h5-14,19,24,27H,3-4,15-18H2,1-2H3 |
| InChIKey | XGMVFHBEINPEJU-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |